C20H30O5 — CID 154694764
4-[6,7a-dihydroxy-1-(2-hydroxyacetyl)-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-3-ethyl-4-methylcyclohex-2-en-1-one (PubChem CID 154694764) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[6,7a-dihydroxy-1-(2-hydroxyacetyl)-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-3-ethyl-4-methylcyclohex-2-en-1-one.
| Compound Name | 4-[6,7a-dihydroxy-1-(2-hydroxyacetyl)-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-3-ethyl-4-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 154694764 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-[6,7a-dihydroxy-1-(2-hydroxyacetyl)-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-3-ethyl-4-methylcyclohex-2-en-1-one |
| SMILES | CCC1=CC(=O)CCC1(C)C1CC2CCC(C(=O)CO)C2(O)CC1O |
| InChI | InChI=1S/C20H30O5/c1-3-12-8-14(22)6-7-19(12,2)16-9-13-4-5-15(18(24)11-21)20(13,25)10-17(16)23/h8,13,15-17,21,23,25H,3-7,9-11H2,1-2H3 |
| InChIKey | ZVADKGVOGJKMHM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |