C30H46N2O8 — CID 170739816
[2-[5-(2-ethyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)-6,7a-dihydroxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-oxoethyl] 3-[(2-amino-3-methylbutanoyl)amino]oxy-2-methylbutanoate (PubChem CID 170739816) has the molecular formula C30H46N2O8 and a molecular weight of 562.70 g/mol. Its IUPAC name is [2-[5-(2-ethyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)-6,7a-dihydroxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-oxoethyl] 3-[(2-amino-3-methylbutanoyl)amino]oxy-2-methylbutanoate.
| Compound Name | [2-[5-(2-ethyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)-6,7a-dihydroxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-oxoethyl] 3-[(2-amino-3-methylbutanoyl)amino]oxy-2-methylbutanoate |
|---|---|
| PubChem CID | 170739816 |
| Molecular Formula | C30H46N2O8 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | [2-[5-(2-ethyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)-6,7a-dihydroxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-oxoethyl] 3-[(2-amino-3-methylbutanoyl)amino]oxy-2-methylbutanoate |
| SMILES | CCC1=CC(=O)C=CC1(C)C1CC2CCC(C(=O)COC(=O)C(C)C(C)ONC(=O)C(N)C(C)C)C2(O)CC1O |
| InChI | InChI=1S/C30H46N2O8/c1-7-19-12-21(33)10-11-29(19,6)23-13-20-8-9-22(30(20,38)14-24(23)34)25(35)15-39-28(37)17(4)18(5)40-32-27(36)26(31)16(2)3/h10-12,16-18,20,22-24,26,34,38H,7-9,13-15,31H2,1-6H3,(H,32,36) |
| InChIKey | AWCJYMOWLSNHFA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|