C11H14Cl2O3 — CID 154694821
(3,5-dichloro-4-hydroxyphenyl)methyl acetate;ethane (PubChem CID 154694821) has the molecular formula C11H14Cl2O3 and a molecular weight of 265.14 g/mol. Its IUPAC name is (3,5-dichloro-4-hydroxyphenyl)methyl acetate;ethane.
| Compound Name | (3,5-dichloro-4-hydroxyphenyl)methyl acetate;ethane |
|---|---|
| PubChem CID | 154694821 |
| Molecular Formula | C11H14Cl2O3 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (3,5-dichloro-4-hydroxyphenyl)methyl acetate;ethane |
| SMILES | CC.CC(=O)OCc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2O3.C2H6/c1-5(12)14-4-6-2-7(10)9(13)8(11)3-6;1-2/h2-3,13H,4H2,1H3;1-2H3 |
| InChIKey | RNZXNPUOVMHBDF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |