C11H10Cl2O2 — CID 58716056
1-(3,5-dichloro-4-hydroxyphenyl)-3-methylbut-3-en-2-one (PubChem CID 58716056) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-hydroxyphenyl)-3-methylbut-3-en-2-one.
| Compound Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 58716056 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(=O)Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2O2/c1-6(2)10(14)5-7-3-8(12)11(15)9(13)4-7/h3-4,15H,1,5H2,2H3 |
| InChIKey | JFKBZTISADUOPT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|