C16H14Cl2O2 — CID 58192631
1-(3,5-dichloro-4-hydroxyphenyl)-4-phenylbutan-2-one (PubChem CID 58192631) has the molecular formula C16H14Cl2O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-hydroxyphenyl)-4-phenylbutan-2-one.
| Compound Name | 1-(3,5-dichloro-4-hydroxyphenyl)-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 58192631 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(3,5-dichloro-4-hydroxyphenyl)-4-phenylbutan-2-one |
| SMILES | O=C(CCc1ccccc1)Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O2/c17-14-9-12(10-15(18)16(14)20)8-13(19)7-6-11-4-2-1-3-5-11/h1-5,9-10,20H,6-8H2 |
| InChIKey | YVFFUNILUOMTLI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |