About 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine
3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine (PubChem CID 154695378) has the molecular formula C20H30N2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine |
| PubChem CID | 154695378 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine |
| SMILES | CCCc1ccnc(C)c1.Cc1cncc(C)c1CC(C)C |
| InChI | InChI=1S/C11H17N.C9H13N/c1-8(2)5-11-9(3)6-12-7-10(11)4;1-3-4-9-5-6-10-8(2)7-9/h6-8H,5H2,1-4H3;5-7H,3-4H2,1-2H3 |
| InChIKey | MNAARBYDLGHMLX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine?
The IUPAC name of 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine (CID 154695378) is 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine.
What is the SMILES notation for 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine?
The canonical SMILES for 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine is CCCc1ccnc(C)c1.Cc1cncc(C)c1CC(C)C.
What is the InChIKey of 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine?
The InChIKey is MNAARBYDLGHMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.C9H13N/c1-8(2)5-11-9(3)6-12-7-10(11)4;1-3-4-9-5-6-10-8(2)7-9/h6-8H,5H2,1-4H3;5-7H,3-4H2,1-2H3.
What are the key properties of 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine?
3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine has a molecular weight of 298.47 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(2-methylpropyl)pyridine;2-methyl-4-propylpyridine is sourced from PubChem (CID 154695378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).