C26H23BFN6O2S+ — CID 154701653
N-(3-azidopropyl)-2-[4-[(E)-2-(2-fluoro-12-thiophen-2-yl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)ethenyl]phenoxy]acetamide (PubChem CID 154701653) has the molecular formula C26H23BFN6O2S+ and a molecular weight of 513.39 g/mol. Its IUPAC name is N-(3-azidopropyl)-2-[4-[(E)-2-(2-fluoro-12-thiophen-2-yl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)ethenyl]phenoxy]acetamide.
| Compound Name | N-(3-azidopropyl)-2-[4-[(E)-2-(2-fluoro-12-thiophen-2-yl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)ethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 154701653 |
| Molecular Formula | C26H23BFN6O2S+ |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-(3-azidopropyl)-2-[4-[(E)-2-(2-fluoro-12-thiophen-2-yl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)ethenyl]phenoxy]acetamide |
| SMILES | [N-]=[N+]=NCCCNC(=O)COc1ccc(/C=C/c2ccc3n2B(F)[N+]2=C(c4cccs4)C=CC2=C3)cc1 |
| InChI | InChI=1S/C26H22BFN6O2S/c28-27-33-20(8-9-21(33)17-22-10-13-24(34(22)27)25-3-1-16-37-25)7-4-19-5-11-23(12-6-19)36-18-26(35)30-14-2-15-31-32-29/h1,3-13,16-17H,2,14-15,18H2/p+1/b7-4+ |
| InChIKey | OJGAYOFTLLWEPT-QPJJXVBHSA-O |
| XLogP | 5.14 |
| TPSA | 95.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|