C12H21NSSi — CID 154701908
triethyl-[(E)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]silane (PubChem CID 154701908) has the molecular formula C12H21NSSi and a molecular weight of 239.46 g/mol. Its IUPAC name is triethyl-[(E)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]silane.
| Compound Name | triethyl-[(E)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]silane |
|---|---|
| PubChem CID | 154701908 |
| Molecular Formula | C12H21NSSi |
| Molecular Weight | 239.46 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | triethyl-[(E)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]silane |
| SMILES | CC[Si](/C=C/c1scnc1C)(CC)CC |
| InChI | InChI=1S/C12H21NSSi/c1-5-15(6-2,7-3)9-8-12-11(4)13-10-14-12/h8-10H,5-7H2,1-4H3/b9-8+ |
| InChIKey | IDOYNELRXAGRRJ-CMDGGOBGSA-N |
| XLogP | 4.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|