C8H8FNS — CID 168979368
5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,3-thiazole (PubChem CID 168979368) has the molecular formula C8H8FNS and a molecular weight of 169.22 g/mol. Its IUPAC name is 5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 168979368 |
| Molecular Formula | C8H8FNS |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,3-thiazole |
| SMILES | C=C/C(F)=C\c1scnc1C |
| InChI | InChI=1S/C8H8FNS/c1-3-7(9)4-8-6(2)10-5-11-8/h3-5H,1H2,2H3/b7-4+ |
| InChIKey | SCVKGBUQJQNOJE-QPJJXVBHSA-N |
| XLogP | 2.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|