C8H7FINS — CID 163757497
4-[(1Z)-3-fluorobuta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole (PubChem CID 163757497) has the molecular formula C8H7FINS and a molecular weight of 295.12 g/mol. Its IUPAC name is 4-[(1Z)-3-fluorobuta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole.
| Compound Name | 4-[(1Z)-3-fluorobuta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 163757497 |
| Molecular Formula | C8H7FINS |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 4-[(1Z)-3-fluorobuta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole |
| SMILES | C=C(F)/C=C\c1nc(I)sc1C |
| InChI | InChI=1S/C8H7FINS/c1-5(9)3-4-7-6(2)12-8(10)11-7/h3-4H,1H2,2H3/b4-3- |
| InChIKey | LVIKDQDNWGALFZ-ARJAWSKDSA-N |
| XLogP | 3.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|