C26H32N8O4 — CID 154702417
6-amino-2-butoxy-9-[[6-[[6-[(oxan-4-ylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702417) has the molecular formula C26H32N8O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[[6-[(oxan-4-ylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[[6-[(oxan-4-ylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702417 |
| Molecular Formula | C26H32N8O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[[6-[(oxan-4-ylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4ccc(CNC5CCOCC5)nc4)nc3)c2n1 |
| InChI | InChI=1S/C26H32N8O4/c1-2-3-10-37-25-32-23(27)22-24(33-25)34(26(35)31-22)16-17-4-7-21(30-13-17)38-20-6-5-19(29-15-20)14-28-18-8-11-36-12-9-18/h4-7,13,15,18,28H,2-3,8-12,14,16H2,1H3,(H,31,35)(H2,27,32,33) |
| InChIKey | KEEGYGJGXDTPLU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|