C24H30N8O4 — CID 154702418
6-amino-2-butoxy-9-[[6-[[6-[(2-methoxyethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702418) has the molecular formula C24H30N8O4 and a molecular weight of 494.56 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[[6-[(2-methoxyethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[[6-[(2-methoxyethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702418 |
| Molecular Formula | C24H30N8O4 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[[6-[(2-methoxyethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4ccc(CNCCOC)nc4)nc3)c2n1 |
| InChI | InChI=1S/C24H30N8O4/c1-3-4-10-35-23-30-21(25)20-22(31-23)32(24(33)29-20)15-16-5-8-19(28-12-16)36-18-7-6-17(27-14-18)13-26-9-11-34-2/h5-8,12,14,26H,3-4,9-11,13,15H2,1-2H3,(H,29,33)(H2,25,30,31) |
| InChIKey | LGDLVCPDYSREOG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|