C25H30N8O4 — CID 154702421
6-amino-2-butoxy-9-[[6-[[6-(morpholin-4-ylmethyl)-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702421) has the molecular formula C25H30N8O4 and a molecular weight of 506.57 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[[6-(morpholin-4-ylmethyl)-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[[6-(morpholin-4-ylmethyl)-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702421 |
| Molecular Formula | C25H30N8O4 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[[6-(morpholin-4-ylmethyl)-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4ccc(CN5CCOCC5)nc4)nc3)c2n1 |
| InChI | InChI=1S/C25H30N8O4/c1-2-3-10-36-24-30-22(26)21-23(31-24)33(25(34)29-21)15-17-4-7-20(28-13-17)37-19-6-5-18(27-14-19)16-32-8-11-35-12-9-32/h4-7,13-14H,2-3,8-12,15-16H2,1H3,(H,29,34)(H2,26,30,31) |
| InChIKey | VJNVUQIFCLNGOX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|