C26H33N9O3 — CID 154702422
6-amino-2-butoxy-9-[[6-[[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702422) has the molecular formula C26H33N9O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702422 |
| Molecular Formula | C26H33N9O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4ccc(CN5CCN(C)CC5)nc4)nc3)c2n1 |
| InChI | InChI=1S/C26H33N9O3/c1-3-4-13-37-25-31-23(27)22-24(32-25)35(26(36)30-22)16-18-5-8-21(29-14-18)38-20-7-6-19(28-15-20)17-34-11-9-33(2)10-12-34/h5-8,14-15H,3-4,9-13,16-17H2,1-2H3,(H,30,36)(H2,27,31,32) |
| InChIKey | OPJZIGJITNOFLF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|