C26H28N4O2 — CID 154704332
N-[[2-[(4-benzylmorpholin-2-yl)methoxy]phenyl]methyl]-1H-benzimidazol-2-amine (PubChem CID 154704332) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[[2-[(4-benzylmorpholin-2-yl)methoxy]phenyl]methyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[[2-[(4-benzylmorpholin-2-yl)methoxy]phenyl]methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 154704332 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[[2-[(4-benzylmorpholin-2-yl)methoxy]phenyl]methyl]-1H-benzimidazol-2-amine |
| SMILES | c1ccc(CN2CCOC(COc3ccccc3CNc3nc4ccccc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-2-8-20(9-3-1)17-30-14-15-31-22(18-30)19-32-25-13-7-4-10-21(25)16-27-26-28-23-11-5-6-12-24(23)29-26/h1-13,22H,14-19H2,(H2,27,28,29) |
| InChIKey | NHKHTSPTQCEFRR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |