C11H12ClN3O — CID 154705208
6-chloro-5-(1,4-oxazepan-4-yl)pyridine-2-carbonitrile (PubChem CID 154705208) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 6-chloro-5-(1,4-oxazepan-4-yl)pyridine-2-carbonitrile.
| Compound Name | 6-chloro-5-(1,4-oxazepan-4-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 154705208 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-chloro-5-(1,4-oxazepan-4-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCCOCC2)c(Cl)n1 |
| InChI | InChI=1S/C11H12ClN3O/c12-11-10(3-2-9(8-13)14-11)15-4-1-6-16-7-5-15/h2-3H,1,4-7H2 |
| InChIKey | JBOUCKMNDDJWBC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|