C18H23N5OS — CID 154706314
2-(benzotriazol-1-yl)-N-[2-(dimethylamino)propyl]-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 154706314) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[2-(dimethylamino)propyl]-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[2-(dimethylamino)propyl]-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 154706314 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[2-(dimethylamino)propyl]-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | CC(CN(Cc1ccsc1)C(=O)Cn1nnc2ccccc21)N(C)C |
| InChI | InChI=1S/C18H23N5OS/c1-14(21(2)3)10-22(11-15-8-9-25-13-15)18(24)12-23-17-7-5-4-6-16(17)19-20-23/h4-9,13-14H,10-12H2,1-3H3 |
| InChIKey | UKIFFUQGJIPMDC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |