C26H23N5OS — CID 56932136
2-(benzotriazol-1-yl)-N-[4-(benzylamino)phenyl]-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 56932136) has the molecular formula C26H23N5OS and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[4-(benzylamino)phenyl]-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[4-(benzylamino)phenyl]-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 56932136 |
| Molecular Formula | C26H23N5OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[4-(benzylamino)phenyl]-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | O=C(Cn1nnc2ccccc21)N(Cc1ccsc1)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5OS/c32-26(18-31-25-9-5-4-8-24(25)28-29-31)30(17-21-14-15-33-19-21)23-12-10-22(11-13-23)27-16-20-6-2-1-3-7-20/h1-15,19,27H,16-18H2 |
| InChIKey | VMXGIQPEEZEPLM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |