C3HBrF2N2S — CID 154706545
5-bromo-3-(difluoromethyl)-1,2,4-thiadiazole (PubChem CID 154706545) has the molecular formula C3HBrF2N2S and a molecular weight of 215.02 g/mol. Its IUPAC name is 5-bromo-3-(difluoromethyl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(difluoromethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 154706545 |
| Molecular Formula | C3HBrF2N2S |
| Molecular Weight | 215.02 g/mol |
| Exact Mass | 213.90 |
| IUPAC Name | 5-bromo-3-(difluoromethyl)-1,2,4-thiadiazole |
| SMILES | FC(F)c1nsc(Br)n1 |
| InChI | InChI=1S/C3HBrF2N2S/c4-3-7-2(1(5)6)8-9-3/h1H |
| InChIKey | SNXUKQDHUKDIKS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.02 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |