C3H3F2N3S — CID 105429510
3-(difluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 105429510) has the molecular formula C3H3F2N3S and a molecular weight of 151.14 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(difluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 105429510 |
| Molecular Formula | C3H3F2N3S |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.00 |
| IUPAC Name | 3-(difluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(C(F)F)ns1 |
| InChI | InChI=1S/C3H3F2N3S/c4-1(5)2-7-3(6)9-8-2/h1H,(H2,6,7,8) |
| InChIKey | UGCOYCRCLYMZCP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |