C4H6FN3S — CID 174597237
3-(1-fluoroethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 174597237) has the molecular formula C4H6FN3S and a molecular weight of 147.18 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(1-fluoroethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 174597237 |
| Molecular Formula | C4H6FN3S |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 3-(1-fluoroethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(F)c1nsc(N)n1 |
| InChI | InChI=1S/C4H6FN3S/c1-2(5)3-7-4(6)9-8-3/h2H,1H3,(H2,6,7,8) |
| InChIKey | MRQUXTQSPPKNPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |