C12H19NO2 — CID 15470676
methyl (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate (PubChem CID 15470676) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15470676 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C1=CCCCC1 |
| InChI | InChI=1S/C12H19NO2/c1-15-12(14)11-8-5-9-13(11)10-6-3-2-4-7-10/h6,11H,2-5,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | PCVVCIIZNQSLAY-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |