C11H17NO2 — CID 101234963
(2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylic acid (PubChem CID 101234963) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 101234963 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C1=CCCCC1 |
| InChI | InChI=1S/C11H17NO2/c13-11(14)10-7-4-8-12(10)9-5-2-1-3-6-9/h5,10H,1-4,6-8H2,(H,13,14)/t10-/m0/s1 |
| InChIKey | FGOQJKISPWOYSX-JTQLQIEISA-N |
| XLogP | 1.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |