C15H25NO2 — CID 122572708
(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2-carboxylic acid (PubChem CID 122572708) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122572708 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C/CN1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C15H25NO2/c1-12(2)6-4-7-13(3)9-11-16-10-5-8-14(16)15(17)18/h6,9,14H,4-5,7-8,10-11H2,1-3H3,(H,17,18)/b13-9+/t14-/m0/s1 |
| InChIKey | HHSGZQQWAXEOHS-SSUFTNFISA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|