C12H18O3 — CID 154706967
(6Z)-12-methyl-1-oxacyclododec-6-ene-2,9-dione (PubChem CID 154706967) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (6Z)-12-methyl-1-oxacyclododec-6-ene-2,9-dione.
| Compound Name | (6Z)-12-methyl-1-oxacyclododec-6-ene-2,9-dione |
|---|---|
| PubChem CID | 154706967 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (6Z)-12-methyl-1-oxacyclododec-6-ene-2,9-dione |
| SMILES | CC1CCC(=O)C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-10-8-9-11(13)6-4-2-3-5-7-12(14)15-10/h2,4,10H,3,5-9H2,1H3/b4-2- |
| InChIKey | DVXOGUNIBAMOLT-RQOWECAXSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|