C18H10F6 — CID 154707500
9-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]phenanthrene (PubChem CID 154707500) has the molecular formula C18H10F6 and a molecular weight of 340.27 g/mol. Its IUPAC name is 9-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]phenanthrene.
| Compound Name | 9-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]phenanthrene |
|---|---|
| PubChem CID | 154707500 |
| Molecular Formula | C18H10F6 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 9-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]phenanthrene |
| SMILES | FC(F)(F)/C=C(\c1cc2ccccc2c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C18H10F6/c19-17(20,21)10-16(18(22,23)24)15-9-11-5-1-2-6-12(11)13-7-3-4-8-14(13)15/h1-10H/b16-10+ |
| InChIKey | LOHBKTXQTMEVLH-MHWRWJLKSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|