C15H22O2P+ — CID 154708027
ethyl 2-[1-(2,4,6-trimethylphenyl)phosphiran-1-ium-1-yl]acetate (PubChem CID 154708027) has the molecular formula C15H22O2P+ and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 2-[1-(2,4,6-trimethylphenyl)phosphiran-1-ium-1-yl]acetate.
| Compound Name | ethyl 2-[1-(2,4,6-trimethylphenyl)phosphiran-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 154708027 |
| Molecular Formula | C15H22O2P+ |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | ethyl 2-[1-(2,4,6-trimethylphenyl)phosphiran-1-ium-1-yl]acetate |
| SMILES | CCOC(=O)C[P+]1(c2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C15H22O2P/c1-5-17-14(16)10-18(6-7-18)15-12(3)8-11(2)9-13(15)4/h8-9H,5-7,10H2,1-4H3/q+1 |
| InChIKey | KSPPJSGBGDLEEX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|