C19H9F9N2 — CID 154708159
4-(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 154708159) has the molecular formula C19H9F9N2 and a molecular weight of 436.28 g/mol. Its IUPAC name is 4-(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 4-(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 154708159 |
| Molecular Formula | C19H9F9N2 |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | FC(F)(F)c1ccc(-c2cc(C(F)(F)F)nc(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H9F9N2/c20-17(21,22)12-5-1-10(2-6-12)14-9-15(19(26,27)28)30-16(29-14)11-3-7-13(8-4-11)18(23,24)25/h1-9H |
| InChIKey | TWJMDHDAIAVCGW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |