C28H31FO5 — CID 154708689
diethyl (3aS,5S,6S,6aR)-5-(3-fluorobenzoyl)-6-methyl-6-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate (PubChem CID 154708689) has the molecular formula C28H31FO5 and a molecular weight of 466.55 g/mol. Its IUPAC name is diethyl (3aS,5S,6S,6aR)-5-(3-fluorobenzoyl)-6-methyl-6-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl (3aS,5S,6S,6aR)-5-(3-fluorobenzoyl)-6-methyl-6-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 154708689 |
| Molecular Formula | C28H31FO5 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | diethyl (3aS,5S,6S,6aR)-5-(3-fluorobenzoyl)-6-methyl-6-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2C[C@H](C(=O)c3cccc(F)c3)[C@@](C)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C28H31FO5/c1-4-33-25(31)28(26(32)34-5-2)16-19-15-22(24(30)18-10-9-13-21(29)14-18)27(3,23(19)17-28)20-11-7-6-8-12-20/h6-14,19,22-23H,4-5,15-17H2,1-3H3/t19-,22+,23+,27+/m0/s1 |
| InChIKey | VVNHBTRHJOSBKU-HWRXOPEZSA-N |
| XLogP | 5.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|