C21H21N3O2S — CID 154708744
2-(3-benzyl-4,5-dimethyl-1H-imidazol-2-ylidene)-2-(4-methylphenyl)sulfonylacetonitrile (PubChem CID 154708744) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-(3-benzyl-4,5-dimethyl-1H-imidazol-2-ylidene)-2-(4-methylphenyl)sulfonylacetonitrile.
| Compound Name | 2-(3-benzyl-4,5-dimethyl-1H-imidazol-2-ylidene)-2-(4-methylphenyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 154708744 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-(3-benzyl-4,5-dimethyl-1H-imidazol-2-ylidene)-2-(4-methylphenyl)sulfonylacetonitrile |
| SMILES | CC1=C(C)N(Cc2ccccc2)C(=C(C#N)S(=O)(=O)c2ccc(C)cc2)N1 |
| InChI | InChI=1S/C21H21N3O2S/c1-15-9-11-19(12-10-15)27(25,26)20(13-22)21-23-16(2)17(3)24(21)14-18-7-5-4-6-8-18/h4-12,23H,14H2,1-3H3 |
| InChIKey | NZEAKWAHOIFXDC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|