C13H12N2 — CID 154709221
spiro[5H-pyrrolo[1,2-a]quinoxaline-4,1'-cyclopropane] (PubChem CID 154709221) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is spiro[5H-pyrrolo[1,2-a]quinoxaline-4,1'-cyclopropane].
| Compound Name | spiro[5H-pyrrolo[1,2-a]quinoxaline-4,1'-cyclopropane] |
|---|---|
| PubChem CID | 154709221 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | spiro[5H-pyrrolo[1,2-a]quinoxaline-4,1'-cyclopropane] |
| SMILES | c1ccc2c(c1)NC1(CC1)c1cccn1-2 |
| InChI | InChI=1S/C13H12N2/c1-2-5-11-10(4-1)14-13(7-8-13)12-6-3-9-15(11)12/h1-6,9,14H,7-8H2 |
| InChIKey | JTSOBPPFHGLCPI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |