C17H18O3 — CID 154709342
(2R,3R)-2-[2-(ethoxymethoxy)phenyl]-3-phenyloxirane (PubChem CID 154709342) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2R,3R)-2-[2-(ethoxymethoxy)phenyl]-3-phenyloxirane.
| Compound Name | (2R,3R)-2-[2-(ethoxymethoxy)phenyl]-3-phenyloxirane |
|---|---|
| PubChem CID | 154709342 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2R,3R)-2-[2-(ethoxymethoxy)phenyl]-3-phenyloxirane |
| SMILES | CCOCOc1ccccc1[C@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18O3/c1-2-18-12-19-15-11-7-6-10-14(15)17-16(20-17)13-8-4-3-5-9-13/h3-11,16-17H,2,12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | JZIZHVARBGYHME-IAGOWNOFSA-N |
| XLogP | 3.87 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|