C15H22O3 — CID 123410588
1-tert-butyl-7-(ethoxymethoxy)-1,3-dihydro-2-benzofuran (PubChem CID 123410588) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-tert-butyl-7-(ethoxymethoxy)-1,3-dihydro-2-benzofuran.
| Compound Name | 1-tert-butyl-7-(ethoxymethoxy)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 123410588 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-tert-butyl-7-(ethoxymethoxy)-1,3-dihydro-2-benzofuran |
| SMILES | CCOCOc1cccc2c1C(C(C)(C)C)OC2 |
| InChI | InChI=1S/C15H22O3/c1-5-16-10-18-12-8-6-7-11-9-17-14(13(11)12)15(2,3)4/h6-8,14H,5,9-10H2,1-4H3 |
| InChIKey | FSMARFUUIHIRST-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|