C22H22F6NO5P — CID 154709354
ethyl (E)-3-(N-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]anilino)prop-2-enoate (PubChem CID 154709354) has the molecular formula C22H22F6NO5P and a molecular weight of 525.38 g/mol. Its IUPAC name is ethyl (E)-3-(N-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]anilino)prop-2-enoate.
| Compound Name | ethyl (E)-3-(N-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]anilino)prop-2-enoate |
|---|---|
| PubChem CID | 154709354 |
| Molecular Formula | C22H22F6NO5P |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | ethyl (E)-3-(N-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]anilino)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/N(c1ccccc1)C(c1ccccc1)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C22H22F6NO5P/c1-2-32-19(30)13-14-29(18-11-7-4-8-12-18)20(17-9-5-3-6-10-17)35(31,33-15-21(23,24)25)34-16-22(26,27)28/h3-14,20H,2,15-16H2,1H3/b14-13+ |
| InChIKey | IZLYADVKLOKWNM-BUHFOSPRSA-N |
| XLogP | 6.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|