C18H25F3NO5P — CID 102441463
ethyl (Z)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pent-2-enoate (PubChem CID 102441463) has the molecular formula C18H25F3NO5P and a molecular weight of 423.37 g/mol. Its IUPAC name is ethyl (Z)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pent-2-enoate.
| Compound Name | ethyl (Z)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pent-2-enoate |
|---|---|
| PubChem CID | 102441463 |
| Molecular Formula | C18H25F3NO5P |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | ethyl (Z)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pent-2-enoate |
| SMILES | CCOC(=O)/C=C(/C(Nc1ccc(C)cc1)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H25F3NO5P/c1-5-25-16(23)12-15(28(24,26-6-2)27-7-3)17(18(19,20)21)22-14-10-8-13(4)9-11-14/h8-12,17,22H,5-7H2,1-4H3/b15-12- |
| InChIKey | VFZHNYPSJYGSNH-QINSGFPZSA-N |
| XLogP | 5.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|