C29H20BrNO2 — CID 154710815
2-(2-bromo-4-methoxyphenyl)imino-1,2-dinaphthalen-2-ylethanone (PubChem CID 154710815) has the molecular formula C29H20BrNO2 and a molecular weight of 494.39 g/mol. Its IUPAC name is 2-(2-bromo-4-methoxyphenyl)imino-1,2-dinaphthalen-2-ylethanone.
| Compound Name | 2-(2-bromo-4-methoxyphenyl)imino-1,2-dinaphthalen-2-ylethanone |
|---|---|
| PubChem CID | 154710815 |
| Molecular Formula | C29H20BrNO2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 2-(2-bromo-4-methoxyphenyl)imino-1,2-dinaphthalen-2-ylethanone |
| SMILES | COc1ccc(/N=C(/C(=O)c2ccc3ccccc3c2)c2ccc3ccccc3c2)c(Br)c1 |
| InChI | InChI=1S/C29H20BrNO2/c1-33-25-14-15-27(26(30)18-25)31-28(23-12-10-19-6-2-4-8-21(19)16-23)29(32)24-13-11-20-7-3-5-9-22(20)17-24/h2-18H,1H3/b31-28+ |
| InChIKey | QYTJNYNLDRCIFZ-CCFHIKDMSA-N |
| XLogP | 7.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|