C29H22BrNO2 — CID 154714358
(2R)-2-(2-bromo-4-methoxyanilino)-1,2-dinaphthalen-2-ylethanone (PubChem CID 154714358) has the molecular formula C29H22BrNO2 and a molecular weight of 496.40 g/mol. Its IUPAC name is (2R)-2-(2-bromo-4-methoxyanilino)-1,2-dinaphthalen-2-ylethanone.
| Compound Name | (2R)-2-(2-bromo-4-methoxyanilino)-1,2-dinaphthalen-2-ylethanone |
|---|---|
| PubChem CID | 154714358 |
| Molecular Formula | C29H22BrNO2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (2R)-2-(2-bromo-4-methoxyanilino)-1,2-dinaphthalen-2-ylethanone |
| SMILES | COc1ccc(N[C@@H](C(=O)c2ccc3ccccc3c2)c2ccc3ccccc3c2)c(Br)c1 |
| InChI | InChI=1S/C29H22BrNO2/c1-33-25-14-15-27(26(30)18-25)31-28(23-12-10-19-6-2-4-8-21(19)16-23)29(32)24-13-11-20-7-3-5-9-22(20)17-24/h2-18,28,31H,1H3/t28-/m1/s1 |
| InChIKey | KPUSZPUIGKKVLA-MUUNZHRXSA-N |
| XLogP | 7.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|