C21H16BrF2NO2 — CID 154714356
(2R)-2-(2-bromo-4-methoxyanilino)-1,2-bis(4-fluorophenyl)ethanone (PubChem CID 154714356) has the molecular formula C21H16BrF2NO2 and a molecular weight of 432.26 g/mol. Its IUPAC name is (2R)-2-(2-bromo-4-methoxyanilino)-1,2-bis(4-fluorophenyl)ethanone.
| Compound Name | (2R)-2-(2-bromo-4-methoxyanilino)-1,2-bis(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 154714356 |
| Molecular Formula | C21H16BrF2NO2 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (2R)-2-(2-bromo-4-methoxyanilino)-1,2-bis(4-fluorophenyl)ethanone |
| SMILES | COc1ccc(N[C@@H](C(=O)c2ccc(F)cc2)c2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C21H16BrF2NO2/c1-27-17-10-11-19(18(22)12-17)25-20(13-2-6-15(23)7-3-13)21(26)14-4-8-16(24)9-5-14/h2-12,20,25H,1H3/t20-/m1/s1 |
| InChIKey | QBKCZYMKOKYTME-HXUWFJFHSA-N |
| XLogP | 5.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|