C24H20F2OSe2 — CID 154711565
3,4-bis[(4-fluorophenyl)selanyl]-5,5-dimethyl-2-phenyl-2H-furan (PubChem CID 154711565) has the molecular formula C24H20F2OSe2 and a molecular weight of 520.34 g/mol. Its IUPAC name is 3,4-bis[(4-fluorophenyl)selanyl]-5,5-dimethyl-2-phenyl-2H-furan.
| Compound Name | 3,4-bis[(4-fluorophenyl)selanyl]-5,5-dimethyl-2-phenyl-2H-furan |
|---|---|
| PubChem CID | 154711565 |
| Molecular Formula | C24H20F2OSe2 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | 3,4-bis[(4-fluorophenyl)selanyl]-5,5-dimethyl-2-phenyl-2H-furan |
| SMILES | CC1(C)OC(c2ccccc2)C([Se]c2ccc(F)cc2)=C1[Se]c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20F2OSe2/c1-24(2)23(29-20-14-10-18(26)11-15-20)22(28-19-12-8-17(25)9-13-19)21(27-24)16-6-4-3-5-7-16/h3-15,21H,1-2H3 |
| InChIKey | BMZDSWCXZHVSFC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|