C13H13F3O5S — CID 154711569
[6-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-4-yl] trifluoromethanesulfonate (PubChem CID 154711569) has the molecular formula C13H13F3O5S and a molecular weight of 338.30 g/mol. Its IUPAC name is [6-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-4-yl] trifluoromethanesulfonate.
| Compound Name | [6-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154711569 |
| Molecular Formula | C13H13F3O5S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [6-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-4-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(C2C=C(OS(=O)(=O)C(F)(F)F)CCO2)cc1 |
| InChI | InChI=1S/C13H13F3O5S/c1-19-10-4-2-9(3-5-10)12-8-11(6-7-20-12)21-22(17,18)13(14,15)16/h2-5,8,12H,6-7H2,1H3 |
| InChIKey | JXWISRFXSLWLFV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|