C11H23BO3 — CID 154711836
(1S)-2,2-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol (PubChem CID 154711836) has the molecular formula C11H23BO3 and a molecular weight of 214.11 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol.
| Compound Name | (1S)-2,2-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 154711836 |
| Molecular Formula | C11H23BO3 |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (1S)-2,2-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
| SMILES | CC(C)(C)[C@@H](O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H23BO3/c1-9(2,3)8(13)12-14-10(4,5)11(6,7)15-12/h8,13H,1-7H3/t8-/m1/s1 |
| InChIKey | QPGKUHIWUPBIRG-MRVPVSSYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|