C19H25BFNO4 — CID 154712118
methyl (3S,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 154712118) has the molecular formula C19H25BFNO4 and a molecular weight of 361.22 g/mol. Its IUPAC name is methyl (3S,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl (3S,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 154712118 |
| Molecular Formula | C19H25BFNO4 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | methyl (3S,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1C=C[C@@H](c2ccc(F)cc2)[C@H](B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C19H25BFNO4/c1-18(2)19(3,4)26-20(25-18)16-12-22(17(23)24-5)11-10-15(16)13-6-8-14(21)9-7-13/h6-11,15-16H,12H2,1-5H3/t15-,16+/m0/s1 |
| InChIKey | COKPANLAQREABK-JKSUJKDBSA-N |
| XLogP | 3.97 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|