C18H35BO3Si — CID 154712120
triethyl-[(1S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxysilane (PubChem CID 154712120) has the molecular formula C18H35BO3Si and a molecular weight of 338.37 g/mol. Its IUPAC name is triethyl-[(1S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxysilane.
| Compound Name | triethyl-[(1S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 154712120 |
| Molecular Formula | C18H35BO3Si |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | triethyl-[(1S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C[C@@H](B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C18H35BO3Si/c1-8-23(9-2,10-3)20-16-13-11-15(12-14-16)19-21-17(4,5)18(6,7)22-19/h11,13,15-16H,8-10,12,14H2,1-7H3/t15-,16-/m1/s1 |
| InChIKey | ICRWPJCCBAUQPU-HZPDHXFCSA-N |
| XLogP | 5.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|