C19H37BO3Si — CID 164668677
tert-butyl-dimethyl-[[(6R)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methoxy]silane (PubChem CID 164668677) has the molecular formula C19H37BO3Si and a molecular weight of 352.40 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(6R)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(6R)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 164668677 |
| Molecular Formula | C19H37BO3Si |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(6R)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methoxy]silane |
| SMILES | CC1(C)OB([C@@H]2CCCC=C2CO[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C19H37BO3Si/c1-17(2,3)24(8,9)21-14-15-12-10-11-13-16(15)20-22-18(4,5)19(6,7)23-20/h12,16H,10-11,13-14H2,1-9H3/t16-/m1/s1 |
| InChIKey | VZMBITOJUQJQIC-MRXNPFEDSA-N |
| XLogP | 5.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|