C26H51BO3Si — CID 154711819
tert-butyl-dimethyl-[(10E,12E)-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tetradeca-10,12-dienoxy]silane (PubChem CID 154711819) has the molecular formula C26H51BO3Si and a molecular weight of 450.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(10E,12E)-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tetradeca-10,12-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(10E,12E)-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tetradeca-10,12-dienoxy]silane |
|---|---|
| PubChem CID | 154711819 |
| Molecular Formula | C26H51BO3Si |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | tert-butyl-dimethyl-[(10E,12E)-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tetradeca-10,12-dienoxy]silane |
| SMILES | C/C(=C/C=C/CCCCCCCCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H51BO3Si/c1-23(27-29-25(5,6)26(7,8)30-27)21-19-17-15-13-11-12-14-16-18-20-22-28-31(9,10)24(2,3)4/h17,19,21H,11-16,18,20,22H2,1-10H3/b19-17+,23-21- |
| InChIKey | WTYQJAJDGSYBRX-HQEHMMIPSA-N |
| XLogP | 8.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|