C28H57BO3Si — CID 154713039
tert-butyl-dimethyl-[(4R,6R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexadec-1-en-6-yl]oxysilane (PubChem CID 154713039) has the molecular formula C28H57BO3Si and a molecular weight of 480.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R,6R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexadec-1-en-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4R,6R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexadec-1-en-6-yl]oxysilane |
|---|---|
| PubChem CID | 154713039 |
| Molecular Formula | C28H57BO3Si |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.42 |
| IUPAC Name | tert-butyl-dimethyl-[(4R,6R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexadec-1-en-6-yl]oxysilane |
| SMILES | C=CC[C@H](C[C@@H](CCCCCCCCCC)O[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C28H57BO3Si/c1-12-14-15-16-17-18-19-20-22-25(30-33(10,11)26(3,4)5)23-24(21-13-2)29-31-27(6,7)28(8,9)32-29/h13,24-25H,2,12,14-23H2,1,3-11H3/t24-,25-/m1/s1 |
| InChIKey | BFRNKROGPGXCFZ-JWQCQUIFSA-N |
| XLogP | 9.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|