C21H43BO3Si — CID 134956995
tert-butyl-[(Z,2S)-2,6-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane (PubChem CID 134956995) has the molecular formula C21H43BO3Si and a molecular weight of 382.47 g/mol. Its IUPAC name is tert-butyl-[(Z,2S)-2,6-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S)-2,6-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134956995 |
| Molecular Formula | C21H43BO3Si |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | tert-butyl-[(Z,2S)-2,6-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane |
| SMILES | C/C(=C/B1OC(C)(C)C(C)(C)O1)CCC[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H43BO3Si/c1-17(15-22-24-20(6,7)21(8,9)25-22)13-12-14-18(2)16-23-26(10,11)19(3,4)5/h15,18H,12-14,16H2,1-11H3/b17-15-/t18-/m0/s1 |
| InChIKey | KQJIYFYTEJEAHP-SOBQPUOHSA-N |
| XLogP | 6.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|