C18H37BO3Si — CID 102493052
tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]silane (PubChem CID 102493052) has the molecular formula C18H37BO3Si and a molecular weight of 340.39 g/mol. Its IUPAC name is tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]silane |
|---|---|
| PubChem CID | 102493052 |
| Molecular Formula | C18H37BO3Si |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]silane |
| SMILES | C=C(CCCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H37BO3Si/c1-15(19-21-17(5,6)18(7,8)22-19)13-11-12-14-20-23(9,10)16(2,3)4/h1,11-14H2,2-10H3 |
| InChIKey | HHEAUVHMWVESGX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|