C24H47BO3Si — CID 154713052
tert-butyl-[(1S,3R)-1-cyclohexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane (PubChem CID 154713052) has the molecular formula C24H47BO3Si and a molecular weight of 422.54 g/mol. Its IUPAC name is tert-butyl-[(1S,3R)-1-cyclohexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3R)-1-cyclohexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154713052 |
| Molecular Formula | C24H47BO3Si |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | tert-butyl-[(1S,3R)-1-cyclohexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane |
| SMILES | C=CC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H47BO3Si/c1-11-15-20(25-27-23(5,6)24(7,8)28-25)18-21(19-16-13-12-14-17-19)26-29(9,10)22(2,3)4/h11,19-21H,1,12-18H2,2-10H3/t20-,21+/m1/s1 |
| InChIKey | JZWNJSQQFSBNBV-RTWAWAEBSA-N |
| XLogP | 7.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|