C23H43BO3Si — CID 10597475
tert-butyl-[(E)-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 10597475) has the molecular formula C23H43BO3Si and a molecular weight of 406.49 g/mol. Its IUPAC name is tert-butyl-[(E)-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10597475 |
| Molecular Formula | C23H43BO3Si |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | tert-butyl-[(E)-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C23H43BO3Si/c1-23(2,3)28(4,5)25-18-12-17-24-26-21(19-13-8-6-9-14-19)22(27-24)20-15-10-7-11-16-20/h12,17,19-22H,6-11,13-16,18H2,1-5H3/b17-12+/t21-,22-/m0/s1 |
| InChIKey | QDAMBDAKJCAHAU-XIEWFSOVSA-N |
| XLogP | 6.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|